C14H14O10 — CID 90901057
2-[2,5-bis(carboxymethoxy)-4-(carboxymethyl)phenyl]acetic acid (PubChem CID 90901057) has the molecular formula C14H14O10 and a molecular weight of 342.26 g/mol. Its IUPAC name is 2-[2,5-bis(carboxymethoxy)-4-(carboxymethyl)phenyl]acetic acid.
| Compound Name | 2-[2,5-bis(carboxymethoxy)-4-(carboxymethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 90901057 |
| Molecular Formula | C14H14O10 |
| Molecular Weight | 342.26 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-[2,5-bis(carboxymethoxy)-4-(carboxymethyl)phenyl]acetic acid |
| SMILES | O=C(O)COc1cc(CC(=O)O)c(OCC(=O)O)cc1CC(=O)O |
| InChI | InChI=1S/C14H14O10/c15-11(16)3-7-1-9(23-5-13(19)20)8(4-12(17)18)2-10(7)24-6-14(21)22/h1-2H,3-6H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | YYNNSNLLUQBATE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.26 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |