C13H10O5 — CID 88947014
2-(5-formyl-6-hydroxynaphthalen-2-yl)oxyacetic acid (PubChem CID 88947014) has the molecular formula C13H10O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is 2-(5-formyl-6-hydroxynaphthalen-2-yl)oxyacetic acid.
| Compound Name | 2-(5-formyl-6-hydroxynaphthalen-2-yl)oxyacetic acid |
|---|---|
| PubChem CID | 88947014 |
| Molecular Formula | C13H10O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-(5-formyl-6-hydroxynaphthalen-2-yl)oxyacetic acid |
| SMILES | O=Cc1c(O)ccc2cc(OCC(=O)O)ccc12 |
| InChI | InChI=1S/C13H10O5/c14-6-11-10-3-2-9(18-7-13(16)17)5-8(10)1-4-12(11)15/h1-6,15H,7H2,(H,16,17) |
| InChIKey | FQVKETYZWHAGBN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|