C29H27NO4 — CID 137099107
6-[6-[5-(4-ethoxyphenyl)pentanoyl]-2-pyridinyl]-2-hydroxynaphthalene-1-carbaldehyde (PubChem CID 137099107) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 6-[6-[5-(4-ethoxyphenyl)pentanoyl]-2-pyridinyl]-2-hydroxynaphthalene-1-carbaldehyde.
| Compound Name | 6-[6-[5-(4-ethoxyphenyl)pentanoyl]-2-pyridinyl]-2-hydroxynaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 137099107 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 6-[6-[5-(4-ethoxyphenyl)pentanoyl]-2-pyridinyl]-2-hydroxynaphthalene-1-carbaldehyde |
| SMILES | CCOc1ccc(CCCCC(=O)c2cccc(-c3ccc4c(C=O)c(O)ccc4c3)n2)cc1 |
| InChI | InChI=1S/C29H27NO4/c1-2-34-23-14-10-20(11-15-23)6-3-4-9-29(33)27-8-5-7-26(30-27)22-12-16-24-21(18-22)13-17-28(32)25(24)19-31/h5,7-8,10-19,32H,2-4,6,9H2,1H3 |
| InChIKey | HXCFZBGXZWCKFF-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|