C27H43N2O5P — CID 161107840
5-[4-[[(3-hydroxy-2,2-dimethylpropyl)amino]methyl]-3,5-dimethoxyphenoxy]-N-[(4-methylphenyl)methyl]pentanamide;phosphane (PubChem CID 161107840) has the molecular formula C27H43N2O5P and a molecular weight of 506.62 g/mol. Its IUPAC name is 5-[4-[[(3-hydroxy-2,2-dimethylpropyl)amino]methyl]-3,5-dimethoxyphenoxy]-N-[(4-methylphenyl)methyl]pentanamide;phosphane.
| Compound Name | 5-[4-[[(3-hydroxy-2,2-dimethylpropyl)amino]methyl]-3,5-dimethoxyphenoxy]-N-[(4-methylphenyl)methyl]pentanamide;phosphane |
|---|---|
| PubChem CID | 161107840 |
| Molecular Formula | C27H43N2O5P |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 5-[4-[[(3-hydroxy-2,2-dimethylpropyl)amino]methyl]-3,5-dimethoxyphenoxy]-N-[(4-methylphenyl)methyl]pentanamide;phosphane |
| SMILES | COc1cc(OCCCCC(=O)NCc2ccc(C)cc2)cc(OC)c1CNCC(C)(C)CO.P |
| InChI | InChI=1S/C27H40N2O5.H3P/c1-20-9-11-21(12-10-20)16-29-26(31)8-6-7-13-34-22-14-24(32-4)23(25(15-22)33-5)17-28-18-27(2,3)19-30;/h9-12,14-15,28,30H,6-8,13,16-19H2,1-5H3,(H,29,31);1H3 |
| InChIKey | UJHGXANHZFNPCP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|