C23H30N2O4 — CID 48503193
5-(2,5-dimethylphenoxy)-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]pentanamide (PubChem CID 48503193) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 48503193 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]pentanamide |
| SMILES | COc1ccc(CNC(=O)CNC(=O)CCCCOc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-17-7-8-18(2)21(14-17)29-13-5-4-6-22(26)25-16-23(27)24-15-19-9-11-20(28-3)12-10-19/h7-12,14H,4-6,13,15-16H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | LGRJJYXHVNCLKV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|