C17H18BrNO4 — CID 3484079
5-[(6-bromo-2-methoxynaphthalen-1-yl)methylamino]-5-oxopentanoic acid (PubChem CID 3484079) has the molecular formula C17H18BrNO4 and a molecular weight of 380.24 g/mol. Its IUPAC name is 5-[(6-bromo-2-methoxynaphthalen-1-yl)methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(6-bromo-2-methoxynaphthalen-1-yl)methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 3484079 |
| Molecular Formula | C17H18BrNO4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 5-[(6-bromo-2-methoxynaphthalen-1-yl)methylamino]-5-oxopentanoic acid |
| SMILES | COc1ccc2cc(Br)ccc2c1CNC(=O)CCCC(=O)O |
| InChI | InChI=1S/C17H18BrNO4/c1-23-15-8-5-11-9-12(18)6-7-13(11)14(15)10-19-16(20)3-2-4-17(21)22/h5-9H,2-4,10H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | IWJIURFBCQBEJC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |