C16H22ClNO2 — CID 170889238
1-(4,7-dimethoxynaphthalen-1-yl)butan-2-amine;hydrochloride (PubChem CID 170889238) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 1-(4,7-dimethoxynaphthalen-1-yl)butan-2-amine;hydrochloride.
| Compound Name | 1-(4,7-dimethoxynaphthalen-1-yl)butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170889238 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 1-(4,7-dimethoxynaphthalen-1-yl)butan-2-amine;hydrochloride |
| SMILES | CCC(N)Cc1ccc(OC)c2ccc(OC)cc12.Cl |
| InChI | InChI=1S/C16H21NO2.ClH/c1-4-12(17)9-11-5-8-16(19-3)14-7-6-13(18-2)10-15(11)14;/h5-8,10,12H,4,9,17H2,1-3H3;1H |
| InChIKey | GAADTAZLSHJCTN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |