C25H24O4 — CID 157306599
4-[(4,7-dimethoxynaphthalen-1-yl)methyl]-1,6-dimethoxynaphthalene (PubChem CID 157306599) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is 4-[(4,7-dimethoxynaphthalen-1-yl)methyl]-1,6-dimethoxynaphthalene.
| Compound Name | 4-[(4,7-dimethoxynaphthalen-1-yl)methyl]-1,6-dimethoxynaphthalene |
|---|---|
| PubChem CID | 157306599 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 4-[(4,7-dimethoxynaphthalen-1-yl)methyl]-1,6-dimethoxynaphthalene |
| SMILES | COc1ccc2c(OC)ccc(Cc3ccc(OC)c4ccc(OC)cc34)c2c1 |
| InChI | InChI=1S/C25H24O4/c1-26-18-7-9-20-22(14-18)16(5-11-24(20)28-3)13-17-6-12-25(29-4)21-10-8-19(27-2)15-23(17)21/h5-12,14-15H,13H2,1-4H3 |
| InChIKey | HYBPHIMEDZTRAL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |