C18H26F3NO4 — CID 174165006
1-[2,5-dimethoxy-4-(5,5,5-trifluoropentyl)phenyl]butan-2-ylcarbamic acid (PubChem CID 174165006) has the molecular formula C18H26F3NO4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 1-[2,5-dimethoxy-4-(5,5,5-trifluoropentyl)phenyl]butan-2-ylcarbamic acid.
| Compound Name | 1-[2,5-dimethoxy-4-(5,5,5-trifluoropentyl)phenyl]butan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 174165006 |
| Molecular Formula | C18H26F3NO4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-[2,5-dimethoxy-4-(5,5,5-trifluoropentyl)phenyl]butan-2-ylcarbamic acid |
| SMILES | CCC(Cc1cc(OC)c(CCCCC(F)(F)F)cc1OC)NC(=O)O |
| InChI | InChI=1S/C18H26F3NO4/c1-4-14(22-17(23)24)9-13-11-15(25-2)12(10-16(13)26-3)7-5-6-8-18(19,20)21/h10-11,14,22H,4-9H2,1-3H3,(H,23,24) |
| InChIKey | WONUPBLSGPKFQH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|