C17H22F3NO4 — CID 143432114
1,1,1-trifluoro-5-[4-(3-hydroxypropyl)-2,5-dimethoxyphenyl]-3-imino-4-methylpentan-2-one (PubChem CID 143432114) has the molecular formula C17H22F3NO4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-[4-(3-hydroxypropyl)-2,5-dimethoxyphenyl]-3-imino-4-methylpentan-2-one.
| Compound Name | 1,1,1-trifluoro-5-[4-(3-hydroxypropyl)-2,5-dimethoxyphenyl]-3-imino-4-methylpentan-2-one |
|---|---|
| PubChem CID | 143432114 |
| Molecular Formula | C17H22F3NO4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1,1,1-trifluoro-5-[4-(3-hydroxypropyl)-2,5-dimethoxyphenyl]-3-imino-4-methylpentan-2-one |
| SMILES | [H]/N=C(\C(=O)C(F)(F)F)C(C)Cc1cc(OC)c(CCCO)cc1OC |
| InChI | InChI=1S/C17H22F3NO4/c1-10(15(21)16(23)17(18,19)20)7-12-9-13(24-2)11(5-4-6-22)8-14(12)25-3/h8-10,21-22H,4-7H2,1-3H3/b21-15- |
| InChIKey | GZOCYHXRQZVNOJ-QNGOZBTKSA-N |
| XLogP | 2.96 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|