C14H21NO4 — CID 117421697
4-[4-(dimethylamino)-2,5-dimethoxyphenyl]butanoic acid (PubChem CID 117421697) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[4-(dimethylamino)-2,5-dimethoxyphenyl]butanoic acid.
| Compound Name | 4-[4-(dimethylamino)-2,5-dimethoxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 117421697 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[4-(dimethylamino)-2,5-dimethoxyphenyl]butanoic acid |
| SMILES | COc1cc(N(C)C)c(OC)cc1CCCC(=O)O |
| InChI | InChI=1S/C14H21NO4/c1-15(2)11-9-12(18-3)10(8-13(11)19-4)6-5-7-14(16)17/h8-9H,5-7H2,1-4H3,(H,16,17) |
| InChIKey | CQAVUEMKDIQUPH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |