C17H25NO4 — CID 117492352
4-(2,5-dimethoxy-4-piperidin-1-ylphenyl)butanoic acid (PubChem CID 117492352) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 4-(2,5-dimethoxy-4-piperidin-1-ylphenyl)butanoic acid.
| Compound Name | 4-(2,5-dimethoxy-4-piperidin-1-ylphenyl)butanoic acid |
|---|---|
| PubChem CID | 117492352 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-(2,5-dimethoxy-4-piperidin-1-ylphenyl)butanoic acid |
| SMILES | COc1cc(N2CCCCC2)c(OC)cc1CCCC(=O)O |
| InChI | InChI=1S/C17H25NO4/c1-21-15-12-14(18-9-4-3-5-10-18)16(22-2)11-13(15)7-6-8-17(19)20/h11-12H,3-10H2,1-2H3,(H,19,20) |
| InChIKey | QBGSXIKIHNKEJM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |