C20H32FNO4 — CID 170982889
butyl N-[1-[4-(4-fluorobutyl)-2,5-dimethoxyphenyl]propan-2-yl]carbamate (PubChem CID 170982889) has the molecular formula C20H32FNO4 and a molecular weight of 369.48 g/mol. Its IUPAC name is butyl N-[1-[4-(4-fluorobutyl)-2,5-dimethoxyphenyl]propan-2-yl]carbamate.
| Compound Name | butyl N-[1-[4-(4-fluorobutyl)-2,5-dimethoxyphenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 170982889 |
| Molecular Formula | C20H32FNO4 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | butyl N-[1-[4-(4-fluorobutyl)-2,5-dimethoxyphenyl]propan-2-yl]carbamate |
| SMILES | CCCCOC(=O)NC(C)Cc1cc(OC)c(CCCCF)cc1OC |
| InChI | InChI=1S/C20H32FNO4/c1-5-6-11-26-20(23)22-15(2)12-17-14-18(24-3)16(9-7-8-10-21)13-19(17)25-4/h13-15H,5-12H2,1-4H3,(H,22,23) |
| InChIKey | XEUARQUUBFWYLO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|