C16H22BrNO7 — CID 176633122
[2-(4-bromo-2,5-dimethoxyphenyl)-1,1,2,2-tetradeuterioethyl]carbamoyloxymethyl propan-2-yl carbonate (PubChem CID 176633122) has the molecular formula C16H22BrNO7 and a molecular weight of 424.28 g/mol. Its IUPAC name is [2-(4-bromo-2,5-dimethoxyphenyl)-1,1,2,2-tetradeuterioethyl]carbamoyloxymethyl propan-2-yl carbonate.
| Compound Name | [2-(4-bromo-2,5-dimethoxyphenyl)-1,1,2,2-tetradeuterioethyl]carbamoyloxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 176633122 |
| Molecular Formula | C16H22BrNO7 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | [2-(4-bromo-2,5-dimethoxyphenyl)-1,1,2,2-tetradeuterioethyl]carbamoyloxymethyl propan-2-yl carbonate |
| SMILES | [2H]C([2H])(NC(=O)OCOC(=O)OC(C)C)C([2H])([2H])c1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C16H22BrNO7/c1-10(2)25-16(20)24-9-23-15(19)18-6-5-11-7-14(22-4)12(17)8-13(11)21-3/h7-8,10H,5-6,9H2,1-4H3,(H,18,19)/i5D2,6D2 |
| InChIKey | JQUMSTTUXUQZHY-NZLXMSDQSA-N |
| XLogP | 3.25 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|