C17H23BrN2O8S — CID 168944990
1-[(1,1-dioxothietan-3-yl)carbamoyloxy]ethyl N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]carbamate (PubChem CID 168944990) has the molecular formula C17H23BrN2O8S and a molecular weight of 495.35 g/mol. Its IUPAC name is 1-[(1,1-dioxothietan-3-yl)carbamoyloxy]ethyl N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]carbamate.
| Compound Name | 1-[(1,1-dioxothietan-3-yl)carbamoyloxy]ethyl N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 168944990 |
| Molecular Formula | C17H23BrN2O8S |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 1-[(1,1-dioxothietan-3-yl)carbamoyloxy]ethyl N-[2-(4-bromo-2,5-dimethoxyphenyl)ethyl]carbamate |
| SMILES | COc1cc(CCNC(=O)OC(C)OC(=O)NC2CS(=O)(=O)C2)c(OC)cc1Br |
| InChI | InChI=1S/C17H23BrN2O8S/c1-10(28-17(22)20-12-8-29(23,24)9-12)27-16(21)19-5-4-11-6-15(26-3)13(18)7-14(11)25-2/h6-7,10,12H,4-5,8-9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | BLYNUSKBIVADKY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|