C11H17N3O2 — CID 59654100
2,3-diamino-N-(2-phenoxyethyl)propanamide (PubChem CID 59654100) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2,3-diamino-N-(2-phenoxyethyl)propanamide.
| Compound Name | 2,3-diamino-N-(2-phenoxyethyl)propanamide |
|---|---|
| PubChem CID | 59654100 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 2,3-diamino-N-(2-phenoxyethyl)propanamide |
| SMILES | NCC(N)C(=O)NCCOc1ccccc1 |
| InChI | InChI=1S/C11H17N3O2/c12-8-10(13)11(15)14-6-7-16-9-4-2-1-3-5-9/h1-5,10H,6-8,12-13H2,(H,14,15) |
| InChIKey | JOVVOWJTGHITEL-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|