C17H19N3O3 — CID 141080234
4-[2-[[(2R)-2-amino-2-phenylacetyl]amino]ethoxy]benzamide (PubChem CID 141080234) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-[2-[[(2R)-2-amino-2-phenylacetyl]amino]ethoxy]benzamide.
| Compound Name | 4-[2-[[(2R)-2-amino-2-phenylacetyl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 141080234 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-[2-[[(2R)-2-amino-2-phenylacetyl]amino]ethoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCCNC(=O)[C@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3O3/c18-15(12-4-2-1-3-5-12)17(22)20-10-11-23-14-8-6-13(7-9-14)16(19)21/h1-9,15H,10-11,18H2,(H2,19,21)(H,20,22)/t15-/m1/s1 |
| InChIKey | UZAREFZRVTWSHI-OAHLLOKOSA-N |
| XLogP | 0.98 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|