C17H25N5O5 — CID 95048822
(2R)-3-(4-acetyloxyphenyl)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid (PubChem CID 95048822) has the molecular formula C17H25N5O5 and a molecular weight of 379.42 g/mol. Its IUPAC name is (2R)-3-(4-acetyloxyphenyl)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid.
| Compound Name | (2R)-3-(4-acetyloxyphenyl)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 95048822 |
| Molecular Formula | C17H25N5O5 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (2R)-3-(4-acetyloxyphenyl)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
| SMILES | CC(=O)Oc1ccc(C[C@@H](NC(=O)[C@H](N)CCCN=C(N)N)C(=O)O)cc1 |
| InChI | InChI=1S/C17H25N5O5/c1-10(23)27-12-6-4-11(5-7-12)9-14(16(25)26)22-15(24)13(18)3-2-8-21-17(19)20/h4-7,13-14H,2-3,8-9,18H2,1H3,(H,22,24)(H,25,26)(H4,19,20,21)/t13-,14-/m1/s1 |
| InChIKey | YSCICEYTNFLQFG-ZIAGYGMSSA-N |
| XLogP | -0.90 |
| TPSA | 183.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|