C24H33N7O3 — CID 89470650
[[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-2-amino-5-[[amino-(aminodiazenyl)methylidene]amino]pentanoate (PubChem CID 89470650) has the molecular formula C24H33N7O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-2-amino-5-[[amino-(aminodiazenyl)methylidene]amino]pentanoate.
| Compound Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-2-amino-5-[[amino-(aminodiazenyl)methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 89470650 |
| Molecular Formula | C24H33N7O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | [[2-[4-(4-phenylbutyl)phenyl]acetyl]amino] (2S)-2-amino-5-[[amino-(aminodiazenyl)methylidene]amino]pentanoate |
| SMILES | NN=N/C(N)=N\CCC[C@H](N)C(=O)ONC(=O)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H33N7O3/c25-21(11-6-16-28-24(26)29-31-27)23(33)34-30-22(32)17-20-14-12-19(13-15-20)10-5-4-9-18-7-2-1-3-8-18/h1-3,7-8,12-15,21H,4-6,9-11,16-17,25H2,(H,30,32)(H4,26,27,28,29)/t21-/m0/s1 |
| InChIKey | QITLAUQFWJXBAH-NRFANRHFSA-N |
| XLogP | 2.12 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|