C20H24N4O3 — CID 57149974
benzyl (2R)-2-amino-2-benzoyl-5-(diaminomethylideneamino)pentanoate (PubChem CID 57149974) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is benzyl (2R)-2-amino-2-benzoyl-5-(diaminomethylideneamino)pentanoate.
| Compound Name | benzyl (2R)-2-amino-2-benzoyl-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 57149974 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | benzyl (2R)-2-amino-2-benzoyl-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(N)=NCCC[C@](N)(C(=O)OCc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H24N4O3/c21-19(22)24-13-7-12-20(23,17(25)16-10-5-2-6-11-16)18(26)27-14-15-8-3-1-4-9-15/h1-6,8-11H,7,12-14,23H2,(H4,21,22,24)/t20-/m1/s1 |
| InChIKey | OAJNJCQSDBXYBF-HXUWFJFHSA-N |
| XLogP | 1.36 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|