C30H35N5O6 — CID 22851684
benzyl (2S,4S)-2-amino-2-[3-(diaminomethylideneamino)propyl]-5-(4-hydroxyphenyl)-3-oxo-4-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 22851684) has the molecular formula C30H35N5O6 and a molecular weight of 561.64 g/mol. Its IUPAC name is benzyl (2S,4S)-2-amino-2-[3-(diaminomethylideneamino)propyl]-5-(4-hydroxyphenyl)-3-oxo-4-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | benzyl (2S,4S)-2-amino-2-[3-(diaminomethylideneamino)propyl]-5-(4-hydroxyphenyl)-3-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 22851684 |
| Molecular Formula | C30H35N5O6 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | benzyl (2S,4S)-2-amino-2-[3-(diaminomethylideneamino)propyl]-5-(4-hydroxyphenyl)-3-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | NC(N)=NCCC[C@@](N)(C(=O)OCc1ccccc1)C(=O)[C@H](Cc1ccc(O)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H35N5O6/c31-28(32)34-17-7-16-30(33,27(38)40-19-22-8-3-1-4-9-22)26(37)25(18-21-12-14-24(36)15-13-21)35-29(39)41-20-23-10-5-2-6-11-23/h1-6,8-15,25,36H,7,16-20,33H2,(H,35,39)(H4,31,32,34)/t25-,30-/m0/s1 |
| InChIKey | WQXBVKZCMSKASW-QCDSWUKFSA-N |
| XLogP | 2.29 |
| TPSA | 192.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|