C17H21N5O2 — CID 57091873
(2R)-2-amino-5-(diaminomethylideneamino)-2-(naphthalene-2-carbonyl)pentanamide (PubChem CID 57091873) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is (2R)-2-amino-5-(diaminomethylideneamino)-2-(naphthalene-2-carbonyl)pentanamide.
| Compound Name | (2R)-2-amino-5-(diaminomethylideneamino)-2-(naphthalene-2-carbonyl)pentanamide |
|---|---|
| PubChem CID | 57091873 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (2R)-2-amino-5-(diaminomethylideneamino)-2-(naphthalene-2-carbonyl)pentanamide |
| SMILES | NC(=O)[C@@](N)(CCCN=C(N)N)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H21N5O2/c18-15(24)17(21,8-3-9-22-16(19)20)14(23)13-7-6-11-4-1-2-5-12(11)10-13/h1-2,4-7,10H,3,8-9,21H2,(H2,18,24)(H4,19,20,22)/t17-/m1/s1 |
| InChIKey | MCHQUKIPHFQPAM-QGZVFWFLSA-N |
| XLogP | 0.26 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|