C15H21N3O5 — CID 54023828
(2R,6S)-2,6,7-triamino-7-oxo-2-phenylmethoxycarbonylheptanoic acid (PubChem CID 54023828) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R,6S)-2,6,7-triamino-7-oxo-2-phenylmethoxycarbonylheptanoic acid.
| Compound Name | (2R,6S)-2,6,7-triamino-7-oxo-2-phenylmethoxycarbonylheptanoic acid |
|---|---|
| PubChem CID | 54023828 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2R,6S)-2,6,7-triamino-7-oxo-2-phenylmethoxycarbonylheptanoic acid |
| SMILES | NC(=O)[C@@H](N)CCC[C@@](N)(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21N3O5/c16-11(12(17)19)7-4-8-15(18,13(20)21)14(22)23-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9,16,18H2,(H2,17,19)(H,20,21)/t11-,15+/m0/s1 |
| InChIKey | LATOAPDRCHECGS-XHDPSFHLSA-N |
| XLogP | -0.51 |
| TPSA | 158.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|