C34H35N5O10 — CID 18665274
3-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-[bis(phenylmethoxycarbonyl)amino]-2-[3-(diaminomethylideneamino)propyl]propanedioate (PubChem CID 18665274) has the molecular formula C34H35N5O10 and a molecular weight of 673.68 g/mol. Its IUPAC name is 3-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-[bis(phenylmethoxycarbonyl)amino]-2-[3-(diaminomethylideneamino)propyl]propanedioate.
| Compound Name | 3-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-[bis(phenylmethoxycarbonyl)amino]-2-[3-(diaminomethylideneamino)propyl]propanedioate |
|---|---|
| PubChem CID | 18665274 |
| Molecular Formula | C34H35N5O10 |
| Molecular Weight | 673.68 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | 3-O-benzyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2R)-2-[bis(phenylmethoxycarbonyl)amino]-2-[3-(diaminomethylideneamino)propyl]propanedioate |
| SMILES | NC(N)=NCCC[C@@](C(=O)OCc1ccccc1)(C(=O)ON1C(=O)CCC1=O)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H35N5O10/c35-31(36)37-20-10-19-34(29(42)46-21-24-11-4-1-5-12-24,30(43)49-39-27(40)17-18-28(39)41)38(32(44)47-22-25-13-6-2-7-14-25)33(45)48-23-26-15-8-3-9-16-26/h1-9,11-16H,10,17-23H2,(H4,35,36,37)/t34-/m1/s1 |
| InChIKey | DDBZNUVAUQZASY-UUWRZZSWSA-N |
| XLogP | 3.11 |
| TPSA | 210.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.68 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|