C30H35N5O8 — CID 126504208
azane;2-[bis(phenylmethoxycarbonyl)amino]-5-(diaminomethylideneamino)-2-phenylmethoxycarbonylpentanoic acid (PubChem CID 126504208) has the molecular formula C30H35N5O8 and a molecular weight of 593.64 g/mol. Its IUPAC name is azane;2-[bis(phenylmethoxycarbonyl)amino]-5-(diaminomethylideneamino)-2-phenylmethoxycarbonylpentanoic acid.
| Compound Name | azane;2-[bis(phenylmethoxycarbonyl)amino]-5-(diaminomethylideneamino)-2-phenylmethoxycarbonylpentanoic acid |
|---|---|
| PubChem CID | 126504208 |
| Molecular Formula | C30H35N5O8 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | azane;2-[bis(phenylmethoxycarbonyl)amino]-5-(diaminomethylideneamino)-2-phenylmethoxycarbonylpentanoic acid |
| SMILES | N.NC(N)=NCCCC(C(=O)O)(C(=O)OCc1ccccc1)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H32N4O8.H3N/c31-27(32)33-18-10-17-30(25(35)36,26(37)40-19-22-11-4-1-5-12-22)34(28(38)41-20-23-13-6-2-7-14-23)29(39)42-21-24-15-8-3-9-16-24;/h1-9,11-16H,10,17-21H2,(H,35,36)(H4,31,32,33);1H3 |
| InChIKey | VTOOMBCYAALSFG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 218.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|