C34H35N5O10 — CID 54018943
3-O-benzyl 1-O-(2,5-dihydroxy-1H-pyrrol-3-yl) (2R)-2-[bis(phenylmethoxycarbonyl)amino]-2-[3-(diaminomethylideneamino)propyl]propanedioate (PubChem CID 54018943) has the molecular formula C34H35N5O10 and a molecular weight of 673.68 g/mol. Its IUPAC name is 3-O-benzyl 1-O-(2,5-dihydroxy-1H-pyrrol-3-yl) (2R)-2-[bis(phenylmethoxycarbonyl)amino]-2-[3-(diaminomethylideneamino)propyl]propanedioate.
| Compound Name | 3-O-benzyl 1-O-(2,5-dihydroxy-1H-pyrrol-3-yl) (2R)-2-[bis(phenylmethoxycarbonyl)amino]-2-[3-(diaminomethylideneamino)propyl]propanedioate |
|---|---|
| PubChem CID | 54018943 |
| Molecular Formula | C34H35N5O10 |
| Molecular Weight | 673.68 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | 3-O-benzyl 1-O-(2,5-dihydroxy-1H-pyrrol-3-yl) (2R)-2-[bis(phenylmethoxycarbonyl)amino]-2-[3-(diaminomethylideneamino)propyl]propanedioate |
| SMILES | NC(N)=NCCC[C@@](C(=O)OCc1ccccc1)(C(=O)Oc1cc(O)[nH]c1O)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H35N5O10/c35-31(36)37-18-10-17-34(29(42)46-20-23-11-4-1-5-12-23,30(43)49-26-19-27(40)38-28(26)41)39(32(44)47-21-24-13-6-2-7-14-24)33(45)48-22-25-15-8-3-9-16-25/h1-9,11-16,19,38,40-41H,10,17-18,20-22H2,(H4,35,36,37)/t34-/m1/s1 |
| InChIKey | KXOJGBAYYLVCOV-UUWRZZSWSA-N |
| XLogP | 3.84 |
| TPSA | 229.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|