C31H30Cl2O6 — CID 102389397
diethyl 2-[4,4-bis(4-chlorophenyl)-4-hydroxybut-2-ynyl]-2-[(4-methoxyphenyl)methyl]propanedioate (PubChem CID 102389397) has the molecular formula C31H30Cl2O6 and a molecular weight of 569.48 g/mol. Its IUPAC name is diethyl 2-[4,4-bis(4-chlorophenyl)-4-hydroxybut-2-ynyl]-2-[(4-methoxyphenyl)methyl]propanedioate.
| Compound Name | diethyl 2-[4,4-bis(4-chlorophenyl)-4-hydroxybut-2-ynyl]-2-[(4-methoxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 102389397 |
| Molecular Formula | C31H30Cl2O6 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | diethyl 2-[4,4-bis(4-chlorophenyl)-4-hydroxybut-2-ynyl]-2-[(4-methoxyphenyl)methyl]propanedioate |
| SMILES | CCOC(=O)C(CC#CC(O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1)(Cc1ccc(OC)cc1)C(=O)OCC |
| InChI | InChI=1S/C31H30Cl2O6/c1-4-38-28(34)30(29(35)39-5-2,21-22-7-17-27(37-3)18-8-22)19-6-20-31(36,23-9-13-25(32)14-10-23)24-11-15-26(33)16-12-24/h7-18,36H,4-5,19,21H2,1-3H3 |
| InChIKey | VSTMROZPAFHEHW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|