C11H16N2O10 — CID 90013601
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;carbon dioxide (PubChem CID 90013601) has the molecular formula C11H16N2O10 and a molecular weight of 336.25 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;carbon dioxide.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;carbon dioxide |
|---|---|
| PubChem CID | 90013601 |
| Molecular Formula | C11H16N2O10 |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;carbon dioxide |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O.O=C=O |
| InChI | InChI=1S/C10H16N2O8.CO2/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;2-1-3/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20); |
| InChIKey | LTIZEIWFBFAWRV-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 189.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |