C23H30N4O10S — CID 88854245
2-[[2-[2-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)propyl]-(carboxymethyl)amino]acetic acid (PubChem CID 88854245) has the molecular formula C23H30N4O10S and a molecular weight of 554.58 g/mol. Its IUPAC name is 2-[[2-[2-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)propyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-[2-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)propyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 88854245 |
| Molecular Formula | C23H30N4O10S |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-[[2-[2-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]-3-(4-isothiocyanatophenyl)propyl]-(carboxymethyl)amino]acetic acid |
| SMILES | CC(CN(CC(=O)O)C(Cc1ccc(N=C=S)cc1)CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C23H30N4O10S/c1-15(26(11-21(32)33)12-22(34)35)7-27(13-23(36)37)18(8-25(9-19(28)29)10-20(30)31)6-16-2-4-17(5-3-16)24-14-38/h2-5,15,18H,6-13H2,1H3,(H,28,29)(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | YGENDPIFOBGWIL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 208.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|