C20H38N4O8 — CID 153195675
2-[2-[bis(formyloxymethyl)amino]ethyl-[2-[2-[di(propan-2-yl)amino]ethyl-(formyloxymethyl)amino]ethyl]amino]acetic acid (PubChem CID 153195675) has the molecular formula C20H38N4O8 and a molecular weight of 462.54 g/mol. Its IUPAC name is 2-[2-[bis(formyloxymethyl)amino]ethyl-[2-[2-[di(propan-2-yl)amino]ethyl-(formyloxymethyl)amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[bis(formyloxymethyl)amino]ethyl-[2-[2-[di(propan-2-yl)amino]ethyl-(formyloxymethyl)amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 153195675 |
| Molecular Formula | C20H38N4O8 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 2-[2-[bis(formyloxymethyl)amino]ethyl-[2-[2-[di(propan-2-yl)amino]ethyl-(formyloxymethyl)amino]ethyl]amino]acetic acid |
| SMILES | CC(C)N(CCN(CCN(CCN(COC=O)COC=O)CC(=O)O)COC=O)C(C)C |
| InChI | InChI=1S/C20H38N4O8/c1-18(2)24(19(3)4)10-9-22(12-30-15-25)7-5-21(11-20(28)29)6-8-23(13-31-16-26)14-32-17-27/h15-19H,5-14H2,1-4H3,(H,28,29) |
| InChIKey | WIXPZQUOJMETMK-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|