C17H29N3O9 — CID 170530791
2-[2-[2-[bis(formyloxymethyl)amino]ethyl-(formyloxymethyl)amino]ethyl-(3-methyl-2-oxobutyl)amino]acetic acid (PubChem CID 170530791) has the molecular formula C17H29N3O9 and a molecular weight of 419.43 g/mol. Its IUPAC name is 2-[2-[2-[bis(formyloxymethyl)amino]ethyl-(formyloxymethyl)amino]ethyl-(3-methyl-2-oxobutyl)amino]acetic acid.
| Compound Name | 2-[2-[2-[bis(formyloxymethyl)amino]ethyl-(formyloxymethyl)amino]ethyl-(3-methyl-2-oxobutyl)amino]acetic acid |
|---|---|
| PubChem CID | 170530791 |
| Molecular Formula | C17H29N3O9 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2-[2-[2-[bis(formyloxymethyl)amino]ethyl-(formyloxymethyl)amino]ethyl-(3-methyl-2-oxobutyl)amino]acetic acid |
| SMILES | CC(C)C(=O)CN(CCN(CCN(COC=O)COC=O)COC=O)CC(=O)O |
| InChI | InChI=1S/C17H29N3O9/c1-15(2)16(24)7-19(8-17(25)26)5-3-18(9-27-12-21)4-6-20(10-28-13-22)11-29-14-23/h12-15H,3-11H2,1-2H3,(H,25,26) |
| InChIKey | HLQFPGGSLSVVHA-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 142.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|