C13H15NO6 — CID 7375300
(3R)-3-[bis(carboxymethyl)amino]-3-phenylpropanoic acid (PubChem CID 7375300) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is (3R)-3-[bis(carboxymethyl)amino]-3-phenylpropanoic acid.
| Compound Name | (3R)-3-[bis(carboxymethyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 7375300 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (3R)-3-[bis(carboxymethyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C[C@H](c1ccccc1)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C13H15NO6/c15-11(16)6-10(9-4-2-1-3-5-9)14(7-12(17)18)8-13(19)20/h1-5,10H,6-8H2,(H,15,16)(H,17,18)(H,19,20)/t10-/m1/s1 |
| InChIKey | WGVLFZVYUOLBNN-SNVBAGLBSA-N |
| XLogP | 0.67 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |