C13H19NO4S — CID 79859062
3-[methyl(2-methylsulfonylethyl)amino]-3-phenylpropanoic acid (PubChem CID 79859062) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is 3-[methyl(2-methylsulfonylethyl)amino]-3-phenylpropanoic acid.
| Compound Name | 3-[methyl(2-methylsulfonylethyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 79859062 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-[methyl(2-methylsulfonylethyl)amino]-3-phenylpropanoic acid |
| SMILES | CN(CCS(C)(=O)=O)C(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO4S/c1-14(8-9-19(2,17)18)12(10-13(15)16)11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3,(H,15,16) |
| InChIKey | PZFRJMMAPDAQIX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |