C29H43N5O11S — CID 118565569
2-[2-[[(2R)-2-[bis(formyloxymethyl)amino]-3-[4-(6-oxoheptylcarbamothioylamino)phenyl]propyl]-(formyloxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 118565569) has the molecular formula C29H43N5O11S and a molecular weight of 669.75 g/mol. Its IUPAC name is 2-[2-[[(2R)-2-[bis(formyloxymethyl)amino]-3-[4-(6-oxoheptylcarbamothioylamino)phenyl]propyl]-(formyloxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[[(2R)-2-[bis(formyloxymethyl)amino]-3-[4-(6-oxoheptylcarbamothioylamino)phenyl]propyl]-(formyloxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 118565569 |
| Molecular Formula | C29H43N5O11S |
| Molecular Weight | 669.75 g/mol |
| Exact Mass | 669.27 |
| IUPAC Name | 2-[2-[[(2R)-2-[bis(formyloxymethyl)amino]-3-[4-(6-oxoheptylcarbamothioylamino)phenyl]propyl]-(formyloxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | CC(=O)CCCCCNC(=S)Nc1ccc(C[C@H](CN(CCN(CC(=O)O)CC(=O)O)COC=O)N(COC=O)COC=O)cc1 |
| InChI | InChI=1S/C29H43N5O11S/c1-23(38)5-3-2-4-10-30-29(46)31-25-8-6-24(7-9-25)13-26(34(18-44-21-36)19-45-22-37)14-33(17-43-20-35)12-11-32(15-27(39)40)16-28(41)42/h6-9,20-22,26H,2-5,10-19H2,1H3,(H,39,40)(H,41,42)(H2,30,31,46)/t26-/m1/s1 |
| InChIKey | GAOVXMCMIOYZMG-AREMUKBSSA-N |
| XLogP | 0.50 |
| TPSA | 204.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.75 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|