C33H43N9O12S — CID 166950860
2-[[3-[4-[3-[[(4-azidobenzoyl)amino]methoxy]propylcarbamothioylamino]phenyl]-2-[bis(carboxymethyl)amino]propyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid (PubChem CID 166950860) has the molecular formula C33H43N9O12S and a molecular weight of 789.82 g/mol. Its IUPAC name is 2-[[3-[4-[3-[[(4-azidobenzoyl)amino]methoxy]propylcarbamothioylamino]phenyl]-2-[bis(carboxymethyl)amino]propyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid.
| Compound Name | 2-[[3-[4-[3-[[(4-azidobenzoyl)amino]methoxy]propylcarbamothioylamino]phenyl]-2-[bis(carboxymethyl)amino]propyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 166950860 |
| Molecular Formula | C33H43N9O12S |
| Molecular Weight | 789.82 g/mol |
| Exact Mass | 789.28 |
| IUPAC Name | 2-[[3-[4-[3-[[(4-azidobenzoyl)amino]methoxy]propylcarbamothioylamino]phenyl]-2-[bis(carboxymethyl)amino]propyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)NCOCCCNC(=S)Nc2ccc(CC(CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C33H43N9O12S/c34-39-38-25-8-4-23(5-9-25)32(53)36-21-54-13-1-10-35-33(55)37-24-6-2-22(3-7-24)14-26(42(19-30(49)50)20-31(51)52)15-40(16-27(43)44)11-12-41(17-28(45)46)18-29(47)48/h2-9,26H,1,10-21H2,(H,36,53)(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H2,35,37,55) |
| InChIKey | SNBWRMUEQXDPLP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 307.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.82 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|