C27H44N2O6 — CID 70255945
tert-butyl 2-[[1-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylpropan-2-yl]amino]acetate (PubChem CID 70255945) has the molecular formula C27H44N2O6 and a molecular weight of 492.66 g/mol. Its IUPAC name is tert-butyl 2-[[1-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylpropan-2-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[1-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylpropan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 70255945 |
| Molecular Formula | C27H44N2O6 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | tert-butyl 2-[[1-[bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-3-phenylpropan-2-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(Cc1ccccc1)CN(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H44N2O6/c1-25(2,3)33-22(30)16-28-21(15-20-13-11-10-12-14-20)17-29(18-23(31)34-26(4,5)6)19-24(32)35-27(7,8)9/h10-14,21,28H,15-19H2,1-9H3 |
| InChIKey | YXYXEVPKKKCWQP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|