C27H41N5O2 — CID 145164095
tert-butyl 2-[amino-[(2S)-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-3-phenylpropyl]amino]acetate (PubChem CID 145164095) has the molecular formula C27H41N5O2 and a molecular weight of 467.66 g/mol. Its IUPAC name is tert-butyl 2-[amino-[(2S)-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-3-phenylpropyl]amino]acetate.
| Compound Name | tert-butyl 2-[amino-[(2S)-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-3-phenylpropyl]amino]acetate |
|---|---|
| PubChem CID | 145164095 |
| Molecular Formula | C27H41N5O2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | tert-butyl 2-[amino-[(2S)-2-[[4-(4-methylpiperazin-1-yl)phenyl]methylamino]-3-phenylpropyl]amino]acetate |
| SMILES | CN1CCN(c2ccc(CN[C@@H](Cc3ccccc3)CN(N)CC(=O)OC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C27H41N5O2/c1-27(2,3)34-26(33)21-32(28)20-24(18-22-8-6-5-7-9-22)29-19-23-10-12-25(13-11-23)31-16-14-30(4)15-17-31/h5-13,24,29H,14-21,28H2,1-4H3/t24-/m0/s1 |
| InChIKey | QBJWTNOLBGUMEJ-DEOSSOPVSA-N |
| XLogP | 2.66 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|