C26H38N4O3 — CID 18426578
tert-butyl N-[(3-amino-2-hydroxy-4-phenylbutyl)-[(4-pyrrolidin-1-ylphenyl)methyl]amino]carbamate (PubChem CID 18426578) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is tert-butyl N-[(3-amino-2-hydroxy-4-phenylbutyl)-[(4-pyrrolidin-1-ylphenyl)methyl]amino]carbamate.
| Compound Name | tert-butyl N-[(3-amino-2-hydroxy-4-phenylbutyl)-[(4-pyrrolidin-1-ylphenyl)methyl]amino]carbamate |
|---|---|
| PubChem CID | 18426578 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | tert-butyl N-[(3-amino-2-hydroxy-4-phenylbutyl)-[(4-pyrrolidin-1-ylphenyl)methyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(Cc1ccc(N2CCCC2)cc1)CC(O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C26H38N4O3/c1-26(2,3)33-25(32)28-30(19-24(31)23(27)17-20-9-5-4-6-10-20)18-21-11-13-22(14-12-21)29-15-7-8-16-29/h4-6,9-14,23-24,31H,7-8,15-19,27H2,1-3H3,(H,28,32) |
| InChIKey | MSODUQXNRNDYJD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|