C26H33N5O3 — CID 18369087
tert-butyl N-[(3-amino-2-hydroxy-4-phenylbutyl)-[(4-pyrazin-2-ylphenyl)methyl]amino]carbamate (PubChem CID 18369087) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is tert-butyl N-[(3-amino-2-hydroxy-4-phenylbutyl)-[(4-pyrazin-2-ylphenyl)methyl]amino]carbamate.
| Compound Name | tert-butyl N-[(3-amino-2-hydroxy-4-phenylbutyl)-[(4-pyrazin-2-ylphenyl)methyl]amino]carbamate |
|---|---|
| PubChem CID | 18369087 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | tert-butyl N-[(3-amino-2-hydroxy-4-phenylbutyl)-[(4-pyrazin-2-ylphenyl)methyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(Cc1ccc(-c2cnccn2)cc1)CC(O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C26H33N5O3/c1-26(2,3)34-25(33)30-31(18-24(32)22(27)15-19-7-5-4-6-8-19)17-20-9-11-21(12-10-20)23-16-28-13-14-29-23/h4-14,16,22,24,32H,15,17-18,27H2,1-3H3,(H,30,33) |
| InChIKey | CPTVPQLDUQACSH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|