C24H32N6O3 — CID 23382081
tert-butyl N-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-[[4-(1,2,4-triazol-4-yl)phenyl]methyl]amino]carbamate (PubChem CID 23382081) has the molecular formula C24H32N6O3 and a molecular weight of 452.56 g/mol. Its IUPAC name is tert-butyl N-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-[[4-(1,2,4-triazol-4-yl)phenyl]methyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-[[4-(1,2,4-triazol-4-yl)phenyl]methyl]amino]carbamate |
|---|---|
| PubChem CID | 23382081 |
| Molecular Formula | C24H32N6O3 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | tert-butyl N-[[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-[[4-(1,2,4-triazol-4-yl)phenyl]methyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(Cc1ccc(-n2cnnc2)cc1)C[C@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C24H32N6O3/c1-24(2,3)33-23(32)28-30(15-22(31)21(25)13-18-7-5-4-6-8-18)14-19-9-11-20(12-10-19)29-16-26-27-17-29/h4-12,16-17,21-22,31H,13-15,25H2,1-3H3,(H,28,32)/t21-,22-/m0/s1 |
| InChIKey | DEGAYDBXLLMJNQ-VXKWHMMOSA-N |
| XLogP | 2.44 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|