C25H36N4O4 — CID 91460602
methyl N-[(2S,3S)-1-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 91460602) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is methyl N-[(2S,3S)-1-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,3S)-1-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 91460602 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | methyl N-[(2S,3S)-1-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OC)C(=O)NN(Cc1ccccc1)C[C@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C25H36N4O4/c1-4-18(2)23(27-25(32)33-3)24(31)28-29(16-20-13-9-6-10-14-20)17-22(30)21(26)15-19-11-7-5-8-12-19/h5-14,18,21-23,30H,4,15-17,26H2,1-3H3,(H,27,32)(H,28,31)/t18-,21-,22-,23-/m0/s1 |
| InChIKey | MLKUIZPIUCOMBU-QGQQZZQASA-N |
| XLogP | 2.22 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|