C24H34N4O4 — CID 68686494
[(2S)-1-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 68686494) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is [(2S)-1-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68686494 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | [(2S)-1-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-3,3-dimethyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)O)C(=O)NN(Cc1ccccc1)C[C@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C24H34N4O4/c1-24(2,3)21(26-23(31)32)22(30)27-28(15-18-12-8-5-9-13-18)16-20(29)19(25)14-17-10-6-4-7-11-17/h4-13,19-21,26,29H,14-16,25H2,1-3H3,(H,27,30)(H,31,32)/t19-,20-,21+/m0/s1 |
| InChIKey | CSNVGDICQGPJAE-PCCBWWKXSA-N |
| XLogP | 2.13 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|