C25H36N4O4 — CID 87349548
methyl N-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 87349548) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is methyl N-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 87349548 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | methyl N-[2-[(2S,3S)-3-amino-2-hydroxy-4-phenylbutyl]-2-benzylhydrazinyl]-N-[(2S)-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N(NN(Cc1ccccc1)C[C@H](O)[C@@H](N)Cc1ccccc1)[C@H](C=O)C(C)(C)C |
| InChI | InChI=1S/C25H36N4O4/c1-25(2,3)23(18-30)29(24(32)33-4)27-28(16-20-13-9-6-10-14-20)17-22(31)21(26)15-19-11-7-5-8-12-19/h5-14,18,21-23,27,31H,15-17,26H2,1-4H3/t21-,22-,23+/m0/s1 |
| InChIKey | DCCRZEADILOSSL-RJGXRXQPSA-N |
| XLogP | 2.52 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|