C25H45N5O6 — CID 143930421
2-[[1-(4-aminophenyl)-3-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]propan-2-yl]amino]acetic acid;ethane (PubChem CID 143930421) has the molecular formula C25H45N5O6 and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-[[1-(4-aminophenyl)-3-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]propan-2-yl]amino]acetic acid;ethane.
| Compound Name | 2-[[1-(4-aminophenyl)-3-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]propan-2-yl]amino]acetic acid;ethane |
|---|---|
| PubChem CID | 143930421 |
| Molecular Formula | C25H45N5O6 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.34 |
| IUPAC Name | 2-[[1-(4-aminophenyl)-3-[4,7-bis(carboxymethyl)-1,4,7-triazonan-1-yl]propan-2-yl]amino]acetic acid;ethane |
| SMILES | CC.CC.Nc1ccc(CC(CN2CCN(CC(=O)O)CCN(CC(=O)O)CC2)NCC(=O)O)cc1 |
| InChI | InChI=1S/C21H33N5O6.2C2H6/c22-17-3-1-16(2-4-17)11-18(23-12-19(27)28)13-24-5-7-25(14-20(29)30)9-10-26(8-6-24)15-21(31)32;2*1-2/h1-4,18,23H,5-15,22H2,(H,27,28)(H,29,30)(H,31,32);2*1-2H3 |
| InChIKey | OTZFEOYPHIPXLZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 159.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|