C28H44N4O3 — CID 143073968
ethane;2-[[(4S)-4-hydroxy-1-phenyl-5-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pentan-2-yl]amino]acetic acid;prop-1-ene (PubChem CID 143073968) has the molecular formula C28H44N4O3 and a molecular weight of 484.69 g/mol. Its IUPAC name is ethane;2-[[(4S)-4-hydroxy-1-phenyl-5-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pentan-2-yl]amino]acetic acid;prop-1-ene.
| Compound Name | ethane;2-[[(4S)-4-hydroxy-1-phenyl-5-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pentan-2-yl]amino]acetic acid;prop-1-ene |
|---|---|
| PubChem CID | 143073968 |
| Molecular Formula | C28H44N4O3 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | ethane;2-[[(4S)-4-hydroxy-1-phenyl-5-[4-(pyridin-3-ylmethyl)piperazin-1-yl]pentan-2-yl]amino]acetic acid;prop-1-ene |
| SMILES | C=CC.CC.O=C(O)CNC(Cc1ccccc1)C[C@H](O)CN1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C23H32N4O3.C3H6.C2H6/c28-22(14-21(25-16-23(29)30)13-19-5-2-1-3-6-19)18-27-11-9-26(10-12-27)17-20-7-4-8-24-15-20;1-3-2;1-2/h1-8,15,21-22,25,28H,9-14,16-18H2,(H,29,30);3H,1H2,2H3;1-2H3/t21?,22-;;/m0../s1 |
| InChIKey | ZRKCWOXTPSARNG-AVSYJSCDSA-N |
| XLogP | 3.45 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|