C27H42N6O8 — CID 20707249
2-[4,7-bis(carboxymethyl)-10-[2-[[1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 20707249) has the molecular formula C27H42N6O8 and a molecular weight of 578.67 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-10-[2-[[1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-10-[2-[[1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 20707249 |
| Molecular Formula | C27H42N6O8 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-10-[2-[[1-(methylamino)-3-(4-methylphenyl)-1-oxopropan-2-yl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CNC(=O)C(Cc1ccc(C)cc1)NC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C27H42N6O8/c1-20-3-5-21(6-4-20)15-22(27(41)28-2)29-23(34)16-30-7-9-31(17-24(35)36)11-13-33(19-26(39)40)14-12-32(10-8-30)18-25(37)38/h3-6,22H,7-19H2,1-2H3,(H,28,41)(H,29,34)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | ZSBOGYDGKBOCBN-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 183.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |