About 3-bromo-2-oxopropanoyl chloride
3-bromo-2-oxopropanoyl chloride (PubChem CID 54361054) has the molecular formula C3H2BrClO2
and a molecular weight of 185.40 g/mol. Its IUPAC name is 3-bromo-2-oxopropanoyl chloride.
Molecular Properties
| Compound Name | 3-bromo-2-oxopropanoyl chloride |
| PubChem CID | 54361054 |
| Molecular Formula | C3H2BrClO2 |
| Molecular Weight | 185.40 g/mol |
| Exact Mass | 183.89 |
| IUPAC Name | 3-bromo-2-oxopropanoyl chloride |
| SMILES | O=C(Cl)C(=O)CBr |
| InChI | InChI=1S/C3H2BrClO2/c4-1-2(6)3(5)7/h1H2 |
| InChIKey | UMNDXFOJQBVTOP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-oxopropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-oxopropanoyl chloride?
The IUPAC name of 3-bromo-2-oxopropanoyl chloride (CID 54361054) is 3-bromo-2-oxopropanoyl chloride.
What is the SMILES notation for 3-bromo-2-oxopropanoyl chloride?
The canonical SMILES for 3-bromo-2-oxopropanoyl chloride is O=C(Cl)C(=O)CBr.
What is the InChIKey of 3-bromo-2-oxopropanoyl chloride?
The InChIKey is UMNDXFOJQBVTOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2BrClO2/c4-1-2(6)3(5)7/h1H2.
What are the key properties of 3-bromo-2-oxopropanoyl chloride?
3-bromo-2-oxopropanoyl chloride has a molecular weight of 185.40 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-oxopropanoyl chloride is sourced from PubChem (CID 54361054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).