About oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride
oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride (PubChem CID 174797367) has the molecular formula C9H8Cl4O6
and a molecular weight of 353.97 g/mol. Its IUPAC name is oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride.
Molecular Properties
| Compound Name | oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride |
| PubChem CID | 174797367 |
| Molecular Formula | C9H8Cl4O6 |
| Molecular Weight | 353.97 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride |
| SMILES | CC(=O)C(=O)Cl.CCC(=O)C(=O)Cl.O=C(Cl)C(=O)Cl |
| InChI | InChI=1S/C4H5ClO2.C3H3ClO2.C2Cl2O2/c1-2-3(6)4(5)7;1-2(5)3(4)6;3-1(5)2(4)6/h2H2,1H3;1H3; |
| InChIKey | UYPPDSXDNYBFLM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.97 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride?
The IUPAC name of oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride (CID 174797367) is oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride.
What is the SMILES notation for oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride?
The canonical SMILES for oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride is CC(=O)C(=O)Cl.CCC(=O)C(=O)Cl.O=C(Cl)C(=O)Cl.
What is the InChIKey of oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride?
The InChIKey is UYPPDSXDNYBFLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClO2.C3H3ClO2.C2Cl2O2/c1-2-3(6)4(5)7;1-2(5)3(4)6;3-1(5)2(4)6/h2H2,1H3;1H3;.
What are the key properties of oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride?
oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride has a molecular weight of 353.97 g/mol, XLogP of 1.59, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxalyl dichloride;2-oxobutanoyl chloride;2-oxopropanoyl chloride is sourced from PubChem (CID 174797367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).