C4H3Br3O — CID 74051970
1,3,4-tribromobut-3-en-2-one (PubChem CID 74051970) has the molecular formula C4H3Br3O and a molecular weight of 306.78 g/mol. Its IUPAC name is 1,3,4-tribromobut-3-en-2-one.
| Compound Name | 1,3,4-tribromobut-3-en-2-one |
|---|---|
| PubChem CID | 74051970 |
| Molecular Formula | C4H3Br3O |
| Molecular Weight | 306.78 g/mol |
| Exact Mass | 303.77 |
| IUPAC Name | 1,3,4-tribromobut-3-en-2-one |
| SMILES | O=C(CBr)C(Br)=CBr |
| InChI | InChI=1S/C4H3Br3O/c5-1-3(7)4(8)2-6/h1H,2H2 |
| InChIKey | ARCXGYKRXLSYCC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.78 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|