C6H8Br2N2O — CID 156651097
(E)-5-amino-1,4-dibromo-3-methyliminopent-4-en-2-one (PubChem CID 156651097) has the molecular formula C6H8Br2N2O and a molecular weight of 283.95 g/mol. Its IUPAC name is (E)-5-amino-1,4-dibromo-3-methyliminopent-4-en-2-one.
| Compound Name | (E)-5-amino-1,4-dibromo-3-methyliminopent-4-en-2-one |
|---|---|
| PubChem CID | 156651097 |
| Molecular Formula | C6H8Br2N2O |
| Molecular Weight | 283.95 g/mol |
| Exact Mass | 281.90 |
| IUPAC Name | (E)-5-amino-1,4-dibromo-3-methyliminopent-4-en-2-one |
| SMILES | C/N=C(C(=O)CBr)/C(Br)=C\N |
| InChI | InChI=1S/C6H8Br2N2O/c1-10-6(4(8)3-9)5(11)2-7/h3H,2,9H2,1H3/b4-3+,10-6- |
| InChIKey | FCVAHZUSWKOSTQ-UMJNYJJFSA-N |
| XLogP | 1.22 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.95 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|